C16H30N4O — CID 97101612
(3R)-N'-[[(3S,9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 97101612) has the molecular formula C16H30N4O and a molecular weight of 294.44 g/mol. Its IUPAC name is (3R)-N'-[[(3S,9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | (3R)-N'-[[(3S,9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 97101612 |
| Molecular Formula | C16H30N4O |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | (3R)-N'-[[(3S,9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | C[C@@H]1CCCN(/C(N)=N/C[C@@H]2CN3CCCC[C@@H]3CO2)C1 |
| InChI | InChI=1S/C16H30N4O/c1-13-5-4-8-20(10-13)16(17)18-9-15-11-19-7-3-2-6-14(19)12-21-15/h13-15H,2-12H2,1H3,(H2,17,18)/t13-,14-,15-/m1/s1 |
| InChIKey | CTDSHXSVVDPQQG-RBSFLKMASA-N |
| XLogP | 1.29 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|