C13H25N3O2S — CID 99853971
(3S)-N'-[[(2R)-1,1-dioxothian-2-yl]methyl]-3-methylpiperidine-1-carboximidamide (PubChem CID 99853971) has the molecular formula C13H25N3O2S and a molecular weight of 287.43 g/mol. Its IUPAC name is (3S)-N'-[[(2R)-1,1-dioxothian-2-yl]methyl]-3-methylpiperidine-1-carboximidamide.
| Compound Name | (3S)-N'-[[(2R)-1,1-dioxothian-2-yl]methyl]-3-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 99853971 |
| Molecular Formula | C13H25N3O2S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (3S)-N'-[[(2R)-1,1-dioxothian-2-yl]methyl]-3-methylpiperidine-1-carboximidamide |
| SMILES | C[C@H]1CCCN(/C(N)=N/C[C@H]2CCCCS2(=O)=O)C1 |
| InChI | InChI=1S/C13H25N3O2S/c1-11-5-4-7-16(10-11)13(14)15-9-12-6-2-3-8-19(12,17)18/h11-12H,2-10H2,1H3,(H2,14,15)/t11-,12+/m0/s1 |
| InChIKey | JRMZZWOQJWYQFJ-NWDGAFQWSA-N |
| XLogP | 1.00 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|