C14H26N4OS — CID 99850713
N'-[[(3R,9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methyl]thiomorpholine-4-carboximidamide (PubChem CID 99850713) has the molecular formula C14H26N4OS and a molecular weight of 298.46 g/mol. Its IUPAC name is N'-[[(3R,9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[[(3R,9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 99850713 |
| Molecular Formula | C14H26N4OS |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | N'-[[(3R,9aR)-1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-3-yl]methyl]thiomorpholine-4-carboximidamide |
| SMILES | N/C(=N\C[C@H]1CN2CCCC[C@@H]2CO1)N1CCSCC1 |
| InChI | InChI=1S/C14H26N4OS/c15-14(17-5-7-20-8-6-17)16-9-13-10-18-4-2-1-3-12(18)11-19-13/h12-13H,1-11H2,(H2,15,16)/t12-,13+/m1/s1 |
| InChIKey | XPFQJYXEQXJPDH-OLZOCXBDSA-N |
| XLogP | 0.60 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|