C8H12N4O3 — CID 165498744
[5-(1,2,4-oxadiazol-3-yl)oxolan-2-yl]methylurea (PubChem CID 165498744) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is [5-(1,2,4-oxadiazol-3-yl)oxolan-2-yl]methylurea.
| Compound Name | [5-(1,2,4-oxadiazol-3-yl)oxolan-2-yl]methylurea |
|---|---|
| PubChem CID | 165498744 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | [5-(1,2,4-oxadiazol-3-yl)oxolan-2-yl]methylurea |
| SMILES | NC(=O)NCC1CCC(c2ncon2)O1 |
| InChI | InChI=1S/C8H12N4O3/c9-8(13)10-3-5-1-2-6(15-5)7-11-4-14-12-7/h4-6H,1-3H2,(H3,9,10,13) |
| InChIKey | IPCZXSLPYVKICP-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |