C10H15ClN2O2 — CID 81330389
2-(3-chloropropyl)-5-(5-methyloxolan-2-yl)-1,3,4-oxadiazole (PubChem CID 81330389) has the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. Its IUPAC name is 2-(3-chloropropyl)-5-(5-methyloxolan-2-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(3-chloropropyl)-5-(5-methyloxolan-2-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 81330389 |
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 2-(3-chloropropyl)-5-(5-methyloxolan-2-yl)-1,3,4-oxadiazole |
| SMILES | CC1CCC(c2nnc(CCCCl)o2)O1 |
| InChI | InChI=1S/C10H15ClN2O2/c1-7-4-5-8(14-7)10-13-12-9(15-10)3-2-6-11/h7-8H,2-6H2,1H3 |
| InChIKey | MHNIULZKONABTI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|