C10H12N2O4 — CID 81330282
(E)-3-[5-(5-methyloxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid (PubChem CID 81330282) has the molecular formula C10H12N2O4 and a molecular weight of 224.22 g/mol. Its IUPAC name is (E)-3-[5-(5-methyloxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(5-methyloxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 81330282 |
| Molecular Formula | C10H12N2O4 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | (E)-3-[5-(5-methyloxolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid |
| SMILES | CC1CCC(c2nnc(/C=C/C(=O)O)o2)O1 |
| InChI | InChI=1S/C10H12N2O4/c1-6-2-3-7(15-6)10-12-11-8(16-10)4-5-9(13)14/h4-7H,2-3H2,1H3,(H,13,14)/b5-4+ |
| InChIKey | REMRODHYCFZVOY-SNAWJCMRSA-N |
| XLogP | 1.41 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|