C9H10N2O3S — CID 81252856
(E)-3-[5-(thiolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid (PubChem CID 81252856) has the molecular formula C9H10N2O3S and a molecular weight of 226.26 g/mol. Its IUPAC name is (E)-3-[5-(thiolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(thiolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 81252856 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | (E)-3-[5-(thiolan-2-yl)-1,3,4-oxadiazol-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1nnc(C2CCCS2)o1 |
| InChI | InChI=1S/C9H10N2O3S/c12-8(13)4-3-7-10-11-9(14-7)6-2-1-5-15-6/h3-4,6H,1-2,5H2,(H,12,13)/b4-3+ |
| InChIKey | QAYMLQHQIIASSI-ONEGZZNKSA-N |
| XLogP | 1.74 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|