C11H19N3OS — CID 80596026
N-methyl-3-[5-(thian-2-yl)-1,3,4-oxadiazol-2-yl]propan-1-amine (PubChem CID 80596026) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is N-methyl-3-[5-(thian-2-yl)-1,3,4-oxadiazol-2-yl]propan-1-amine.
| Compound Name | N-methyl-3-[5-(thian-2-yl)-1,3,4-oxadiazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 80596026 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N-methyl-3-[5-(thian-2-yl)-1,3,4-oxadiazol-2-yl]propan-1-amine |
| SMILES | CNCCCc1nnc(C2CCCCS2)o1 |
| InChI | InChI=1S/C11H19N3OS/c1-12-7-4-6-10-13-14-11(15-10)9-5-2-3-8-16-9/h9,12H,2-8H2,1H3 |
| InChIKey | OLOHKUYFWBSMOL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|