C8H12N2O2S — CID 130693373
2-(methoxymethyl)-5-(thiolan-2-yl)-1,3,4-oxadiazole (PubChem CID 130693373) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is 2-(methoxymethyl)-5-(thiolan-2-yl)-1,3,4-oxadiazole.
| Compound Name | 2-(methoxymethyl)-5-(thiolan-2-yl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 130693373 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2-(methoxymethyl)-5-(thiolan-2-yl)-1,3,4-oxadiazole |
| SMILES | COCc1nnc(C2CCCS2)o1 |
| InChI | InChI=1S/C8H12N2O2S/c1-11-5-7-9-10-8(12-7)6-3-2-4-13-6/h6H,2-5H2,1H3 |
| InChIKey | VIMVRQKWPBIGRS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |