C9H14N2O2S — CID 71870137
3-(2-methoxyethyl)-5-(thiolan-2-yl)-1,2,4-oxadiazole (PubChem CID 71870137) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 3-(2-methoxyethyl)-5-(thiolan-2-yl)-1,2,4-oxadiazole.
| Compound Name | 3-(2-methoxyethyl)-5-(thiolan-2-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 71870137 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 3-(2-methoxyethyl)-5-(thiolan-2-yl)-1,2,4-oxadiazole |
| SMILES | COCCc1noc(C2CCCS2)n1 |
| InChI | InChI=1S/C9H14N2O2S/c1-12-5-4-8-10-9(13-11-8)7-3-2-6-14-7/h7H,2-6H2,1H3 |
| InChIKey | SKKUFNHBPBRFDZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |