C11H18N2O2 — CID 115085884
N-methyl-1-[2-(oxan-2-yl)-1,3-oxazol-5-yl]ethanamine (PubChem CID 115085884) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is N-methyl-1-[2-(oxan-2-yl)-1,3-oxazol-5-yl]ethanamine.
| Compound Name | N-methyl-1-[2-(oxan-2-yl)-1,3-oxazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 115085884 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | N-methyl-1-[2-(oxan-2-yl)-1,3-oxazol-5-yl]ethanamine |
| SMILES | CNC(C)c1cnc(C2CCCCO2)o1 |
| InChI | InChI=1S/C11H18N2O2/c1-8(12-2)10-7-13-11(15-10)9-5-3-4-6-14-9/h7-9,12H,3-6H2,1-2H3 |
| InChIKey | XCAVRPXDFXBQCJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |