C9H16ClN3S — CID 63960247
3-chloro-4-(3-methylsulfanylpropyl)-5-propyl-1,2,4-triazole (PubChem CID 63960247) has the molecular formula C9H16ClN3S and a molecular weight of 233.77 g/mol. Its IUPAC name is 3-chloro-4-(3-methylsulfanylpropyl)-5-propyl-1,2,4-triazole.
| Compound Name | 3-chloro-4-(3-methylsulfanylpropyl)-5-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 63960247 |
| Molecular Formula | C9H16ClN3S |
| Molecular Weight | 233.77 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 3-chloro-4-(3-methylsulfanylpropyl)-5-propyl-1,2,4-triazole |
| SMILES | CCCc1nnc(Cl)n1CCCSC |
| InChI | InChI=1S/C9H16ClN3S/c1-3-5-8-11-12-9(10)13(8)6-4-7-14-2/h3-7H2,1-2H3 |
| InChIKey | MYYHEXMRIWBEPC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.77 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|