About 6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine
6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine (PubChem CID 141082432) has the molecular formula C15H23N3S
and a molecular weight of 277.44 g/mol. Its IUPAC name is 6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine |
| PubChem CID | 141082432 |
| Molecular Formula | C15H23N3S |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine |
| SMILES | CCCc1nc2cnc(C)c(C)c2n1CCCSC |
| InChI | InChI=1S/C15H23N3S/c1-5-7-14-17-13-10-16-12(3)11(2)15(13)18(14)8-6-9-19-4/h10H,5-9H2,1-4H3 |
| InChIKey | WOVRZNLJHASVDZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine?
The IUPAC name of 6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine (CID 141082432) is 6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine.
What is the SMILES notation for 6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine?
The canonical SMILES for 6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine is CCCc1nc2cnc(C)c(C)c2n1CCCSC.
What is the InChIKey of 6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine?
The InChIKey is WOVRZNLJHASVDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3S/c1-5-7-14-17-13-10-16-12(3)11(2)15(13)18(14)8-6-9-19-4/h10H,5-9H2,1-4H3.
What are the key properties of 6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine?
6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine has a molecular weight of 277.44 g/mol, XLogP of 3.75, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine is sourced from PubChem (CID 141082432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).