C15H23N3S — CID 141082432
6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine (PubChem CID 141082432) has the molecular formula C15H23N3S and a molecular weight of 277.44 g/mol. Its IUPAC name is 6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine.
| Compound Name | 6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 141082432 |
| Molecular Formula | C15H23N3S |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 6,7-dimethyl-1-(3-methylsulfanylpropyl)-2-propylimidazo[4,5-c]pyridine |
| SMILES | CCCc1nc2cnc(C)c(C)c2n1CCCSC |
| InChI | InChI=1S/C15H23N3S/c1-5-7-14-17-13-10-16-12(3)11(2)15(13)18(14)8-6-9-19-4/h10H,5-9H2,1-4H3 |
| InChIKey | WOVRZNLJHASVDZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|