C14H21N3OS — CID 141082531
2-(ethoxymethyl)-7-methyl-1-(3-methylsulfanylpropyl)imidazo[4,5-c]pyridine (PubChem CID 141082531) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is 2-(ethoxymethyl)-7-methyl-1-(3-methylsulfanylpropyl)imidazo[4,5-c]pyridine.
| Compound Name | 2-(ethoxymethyl)-7-methyl-1-(3-methylsulfanylpropyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 141082531 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-(ethoxymethyl)-7-methyl-1-(3-methylsulfanylpropyl)imidazo[4,5-c]pyridine |
| SMILES | CCOCc1nc2cncc(C)c2n1CCCSC |
| InChI | InChI=1S/C14H21N3OS/c1-4-18-10-13-16-12-9-15-8-11(2)14(12)17(13)6-5-7-19-3/h8-9H,4-7,10H2,1-3H3 |
| InChIKey | VOITUUMWZYSUNB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|