C18H23N5S — CID 141082369
2-ethyl-7-methyl-1-(5-pyrimidin-2-ylsulfanylpentyl)imidazo[4,5-c]pyridine (PubChem CID 141082369) has the molecular formula C18H23N5S and a molecular weight of 341.48 g/mol. Its IUPAC name is 2-ethyl-7-methyl-1-(5-pyrimidin-2-ylsulfanylpentyl)imidazo[4,5-c]pyridine.
| Compound Name | 2-ethyl-7-methyl-1-(5-pyrimidin-2-ylsulfanylpentyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 141082369 |
| Molecular Formula | C18H23N5S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 2-ethyl-7-methyl-1-(5-pyrimidin-2-ylsulfanylpentyl)imidazo[4,5-c]pyridine |
| SMILES | CCc1nc2cncc(C)c2n1CCCCCSc1ncccn1 |
| InChI | InChI=1S/C18H23N5S/c1-3-16-22-15-13-19-12-14(2)17(15)23(16)10-5-4-6-11-24-18-20-8-7-9-21-18/h7-9,12-13H,3-6,10-11H2,1-2H3 |
| InChIKey | MYXVMQSEUYPUFP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|