C17H27N3O2S — CID 141082506
2-butyl-7-methyl-1-(5-methylsulfonylpentyl)imidazo[4,5-c]pyridine (PubChem CID 141082506) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is 2-butyl-7-methyl-1-(5-methylsulfonylpentyl)imidazo[4,5-c]pyridine.
| Compound Name | 2-butyl-7-methyl-1-(5-methylsulfonylpentyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 141082506 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 2-butyl-7-methyl-1-(5-methylsulfonylpentyl)imidazo[4,5-c]pyridine |
| SMILES | CCCCc1nc2cncc(C)c2n1CCCCCS(C)(=O)=O |
| InChI | InChI=1S/C17H27N3O2S/c1-4-5-9-16-19-15-13-18-12-14(2)17(15)20(16)10-7-6-8-11-23(3,21)22/h12-13H,4-11H2,1-3H3 |
| InChIKey | MTWIMPRFJKGFMG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|