C20H30N4O2S — CID 163894520
2-butyl-5-methyl-1-(4-methylsulfonylbutyl)-5aH-imidazo[4,5-c]quinolin-4-amine (PubChem CID 163894520) has the molecular formula C20H30N4O2S and a molecular weight of 390.55 g/mol. Its IUPAC name is 2-butyl-5-methyl-1-(4-methylsulfonylbutyl)-5aH-imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 2-butyl-5-methyl-1-(4-methylsulfonylbutyl)-5aH-imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 163894520 |
| Molecular Formula | C20H30N4O2S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 2-butyl-5-methyl-1-(4-methylsulfonylbutyl)-5aH-imidazo[4,5-c]quinolin-4-amine |
| SMILES | CCCCc1nc2c(n1CCCCS(C)(=O)=O)=C1C=CC=CC1N(C)C=2N |
| InChI | InChI=1S/C20H30N4O2S/c1-4-5-12-17-22-18-19(24(17)13-8-9-14-27(3,25)26)15-10-6-7-11-16(15)23(2)20(18)21/h6-7,10-11,16H,4-5,8-9,12-14,21H2,1-3H3 |
| InChIKey | QELOHXKNWDCDEU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|