C19H23N3OS — CID 141082510
1-[5-(benzenesulfinyl)pentyl]-2,7-dimethylimidazo[4,5-c]pyridine (PubChem CID 141082510) has the molecular formula C19H23N3OS and a molecular weight of 341.48 g/mol. Its IUPAC name is 1-[5-(benzenesulfinyl)pentyl]-2,7-dimethylimidazo[4,5-c]pyridine.
| Compound Name | 1-[5-(benzenesulfinyl)pentyl]-2,7-dimethylimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 141082510 |
| Molecular Formula | C19H23N3OS |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 1-[5-(benzenesulfinyl)pentyl]-2,7-dimethylimidazo[4,5-c]pyridine |
| SMILES | Cc1cncc2nc(C)n(CCCCCS(=O)c3ccccc3)c12 |
| InChI | InChI=1S/C19H23N3OS/c1-15-13-20-14-18-19(15)22(16(2)21-18)11-7-4-8-12-24(23)17-9-5-3-6-10-17/h3,5-6,9-10,13-14H,4,7-8,11-12H2,1-2H3 |
| InChIKey | BMWLBHSUCZKXRJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|