C20H25N3OS — CID 141082298
1-[5-(benzenesulfinyl)pentyl]-2,6,7-trimethylimidazo[4,5-c]pyridine (PubChem CID 141082298) has the molecular formula C20H25N3OS and a molecular weight of 355.51 g/mol. Its IUPAC name is 1-[5-(benzenesulfinyl)pentyl]-2,6,7-trimethylimidazo[4,5-c]pyridine.
| Compound Name | 1-[5-(benzenesulfinyl)pentyl]-2,6,7-trimethylimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 141082298 |
| Molecular Formula | C20H25N3OS |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 1-[5-(benzenesulfinyl)pentyl]-2,6,7-trimethylimidazo[4,5-c]pyridine |
| SMILES | Cc1ncc2nc(C)n(CCCCCS(=O)c3ccccc3)c2c1C |
| InChI | InChI=1S/C20H25N3OS/c1-15-16(2)21-14-19-20(15)23(17(3)22-19)12-8-5-9-13-25(24)18-10-6-4-7-11-18/h4,6-7,10-11,14H,5,8-9,12-13H2,1-3H3 |
| InChIKey | OVYQWKNAKSHVIT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|