C17H19N3OS — CID 141082530
1-[3-(benzenesulfinyl)propyl]-2,7-dimethylimidazo[4,5-c]pyridine (PubChem CID 141082530) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is 1-[3-(benzenesulfinyl)propyl]-2,7-dimethylimidazo[4,5-c]pyridine.
| Compound Name | 1-[3-(benzenesulfinyl)propyl]-2,7-dimethylimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 141082530 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 1-[3-(benzenesulfinyl)propyl]-2,7-dimethylimidazo[4,5-c]pyridine |
| SMILES | Cc1cncc2nc(C)n(CCCS(=O)c3ccccc3)c12 |
| InChI | InChI=1S/C17H19N3OS/c1-13-11-18-12-16-17(13)20(14(2)19-16)9-6-10-22(21)15-7-4-3-5-8-15/h3-5,7-8,11-12H,6,9-10H2,1-2H3 |
| InChIKey | VEXARFBRFMIJJX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |