C18H23N5O2S — CID 141082358
2,6,7-trimethyl-1-(5-pyrimidin-2-ylsulfonylpentyl)imidazo[4,5-c]pyridine (PubChem CID 141082358) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 2,6,7-trimethyl-1-(5-pyrimidin-2-ylsulfonylpentyl)imidazo[4,5-c]pyridine.
| Compound Name | 2,6,7-trimethyl-1-(5-pyrimidin-2-ylsulfonylpentyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 141082358 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2,6,7-trimethyl-1-(5-pyrimidin-2-ylsulfonylpentyl)imidazo[4,5-c]pyridine |
| SMILES | Cc1ncc2nc(C)n(CCCCCS(=O)(=O)c3ncccn3)c2c1C |
| InChI | InChI=1S/C18H23N5O2S/c1-13-14(2)21-12-16-17(13)23(15(3)22-16)10-5-4-6-11-26(24,25)18-19-8-7-9-20-18/h7-9,12H,4-6,10-11H2,1-3H3 |
| InChIKey | CNLDXTQXNVHMDB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 90.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|