About 2-ethyl-7-methyl-1-(3-pyrimidin-2-ylsulfanylpropyl)imidazo[4,5-c]pyridine
2-ethyl-7-methyl-1-(3-pyrimidin-2-ylsulfanylpropyl)imidazo[4,5-c]pyridine (PubChem CID 141082386) has the molecular formula C16H19N5S
and a molecular weight of 313.43 g/mol. Its IUPAC name is 2-ethyl-7-methyl-1-(3-pyrimidin-2-ylsulfanylpropyl)imidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 2-ethyl-7-methyl-1-(3-pyrimidin-2-ylsulfanylpropyl)imidazo[4,5-c]pyridine |
| PubChem CID | 141082386 |
| Molecular Formula | C16H19N5S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-ethyl-7-methyl-1-(3-pyrimidin-2-ylsulfanylpropyl)imidazo[4,5-c]pyridine |
| SMILES | CCc1nc2cncc(C)c2n1CCCSc1ncccn1 |
| InChI | InChI=1S/C16H19N5S/c1-3-14-20-13-11-17-10-12(2)15(13)21(14)8-5-9-22-16-18-6-4-7-19-16/h4,6-7,10-11H,3,5,8-9H2,1-2H3 |
| InChIKey | HJNVJTMOEFELNX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-7-methyl-1-(3-pyrimidin-2-ylsulfanylpropyl)imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-7-methyl-1-(3-pyrimidin-2-ylsulfanylpropyl)imidazo[4,5-c]pyridine?
The IUPAC name of 2-ethyl-7-methyl-1-(3-pyrimidin-2-ylsulfanylpropyl)imidazo[4,5-c]pyridine (CID 141082386) is 2-ethyl-7-methyl-1-(3-pyrimidin-2-ylsulfanylpropyl)imidazo[4,5-c]pyridine.
What is the SMILES notation for 2-ethyl-7-methyl-1-(3-pyrimidin-2-ylsulfanylpropyl)imidazo[4,5-c]pyridine?
The canonical SMILES for 2-ethyl-7-methyl-1-(3-pyrimidin-2-ylsulfanylpropyl)imidazo[4,5-c]pyridine is CCc1nc2cncc(C)c2n1CCCSc1ncccn1.
What is the InChIKey of 2-ethyl-7-methyl-1-(3-pyrimidin-2-ylsulfanylpropyl)imidazo[4,5-c]pyridine?
The InChIKey is HJNVJTMOEFELNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N5S/c1-3-14-20-13-11-17-10-12(2)15(13)21(14)8-5-9-22-16-18-6-4-7-19-16/h4,6-7,10-11H,3,5,8-9H2,1-2H3.
What are the key properties of 2-ethyl-7-methyl-1-(3-pyrimidin-2-ylsulfanylpropyl)imidazo[4,5-c]pyridine?
2-ethyl-7-methyl-1-(3-pyrimidin-2-ylsulfanylpropyl)imidazo[4,5-c]pyridine has a molecular weight of 313.43 g/mol, XLogP of 3.27, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-7-methyl-1-(3-pyrimidin-2-ylsulfanylpropyl)imidazo[4,5-c]pyridine is sourced from PubChem (CID 141082386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).