C16H17N3O — CID 86626643
4-(2-ethylimidazo[4,5-c]quinolin-1-yl)butanal (PubChem CID 86626643) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-(2-ethylimidazo[4,5-c]quinolin-1-yl)butanal.
| Compound Name | 4-(2-ethylimidazo[4,5-c]quinolin-1-yl)butanal |
|---|---|
| PubChem CID | 86626643 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 4-(2-ethylimidazo[4,5-c]quinolin-1-yl)butanal |
| SMILES | CCc1nc2cnc3ccccc3c2n1CCCC=O |
| InChI | InChI=1S/C16H17N3O/c1-2-15-18-14-11-17-13-8-4-3-7-12(13)16(14)19(15)9-5-6-10-20/h3-4,7-8,10-11H,2,5-6,9H2,1H3 |
| InChIKey | XDJLACVWKIKNGP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|