C18H24N4O3S — CID 141135348
5-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]pentane-2-sulfonamide (PubChem CID 141135348) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is 5-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]pentane-2-sulfonamide.
| Compound Name | 5-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]pentane-2-sulfonamide |
|---|---|
| PubChem CID | 141135348 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 5-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]pentane-2-sulfonamide |
| SMILES | CCOCc1nc2cnc3ccccc3c2n1CCCC(C)S(N)(=O)=O |
| InChI | InChI=1S/C18H24N4O3S/c1-3-25-12-17-21-16-11-20-15-9-5-4-8-14(15)18(16)22(17)10-6-7-13(2)26(19,23)24/h4-5,8-9,11,13H,3,6-7,10,12H2,1-2H3,(H2,19,23,24) |
| InChIKey | QTRYHQUQLHVWNA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |