C24H28N4O4S — CID 68999938
4-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-N-(4-methoxyphenyl)butane-1-sulfonamide (PubChem CID 68999938) has the molecular formula C24H28N4O4S and a molecular weight of 468.58 g/mol. Its IUPAC name is 4-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-N-(4-methoxyphenyl)butane-1-sulfonamide.
| Compound Name | 4-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-N-(4-methoxyphenyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 68999938 |
| Molecular Formula | C24H28N4O4S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 4-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-N-(4-methoxyphenyl)butane-1-sulfonamide |
| SMILES | CCOCc1nc2cnc3ccccc3c2n1CCCCS(=O)(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C24H28N4O4S/c1-3-32-17-23-26-22-16-25-21-9-5-4-8-20(21)24(22)28(23)14-6-7-15-33(29,30)27-18-10-12-19(31-2)13-11-18/h4-5,8-13,16,27H,3,6-7,14-15,17H2,1-2H3 |
| InChIKey | BEQBVUVTHXTBOB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|