C19H23N3O2S — CID 91445036
O-[4-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butyl] ethanethioate (PubChem CID 91445036) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is O-[4-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butyl] ethanethioate.
| Compound Name | O-[4-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butyl] ethanethioate |
|---|---|
| PubChem CID | 91445036 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | O-[4-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butyl] ethanethioate |
| SMILES | CCOCc1nc2cnc3ccccc3c2n1CCCCOC(C)=S |
| InChI | InChI=1S/C19H23N3O2S/c1-3-23-13-18-21-17-12-20-16-9-5-4-8-15(16)19(17)22(18)10-6-7-11-24-14(2)25/h4-5,8-9,12H,3,6-7,10-11,13H2,1-2H3 |
| InChIKey | TVPKIFLEUIBZGL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|