C22H29BrN4O3 — CID 91324743
4-[7-bromo-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butyl N-tert-butylcarbamate (PubChem CID 91324743) has the molecular formula C22H29BrN4O3 and a molecular weight of 477.40 g/mol. Its IUPAC name is 4-[7-bromo-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butyl N-tert-butylcarbamate.
| Compound Name | 4-[7-bromo-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 91324743 |
| Molecular Formula | C22H29BrN4O3 |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 4-[7-bromo-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butyl N-tert-butylcarbamate |
| SMILES | CCOCc1nc2cnc3cc(Br)ccc3c2n1CCCCOC(=O)NC(C)(C)C |
| InChI | InChI=1S/C22H29BrN4O3/c1-5-29-14-19-25-18-13-24-17-12-15(23)8-9-16(17)20(18)27(19)10-6-7-11-30-21(28)26-22(2,3)4/h8-9,12-13H,5-7,10-11,14H2,1-4H3,(H,26,28) |
| InChIKey | UPLPKQFVODBKGR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|