C18H21BrN4O2 — CID 68822265
4-(7-bromo-2-propylimidazo[4,5-c]quinolin-1-yl)butylcarbamic acid (PubChem CID 68822265) has the molecular formula C18H21BrN4O2 and a molecular weight of 405.30 g/mol. Its IUPAC name is 4-(7-bromo-2-propylimidazo[4,5-c]quinolin-1-yl)butylcarbamic acid.
| Compound Name | 4-(7-bromo-2-propylimidazo[4,5-c]quinolin-1-yl)butylcarbamic acid |
|---|---|
| PubChem CID | 68822265 |
| Molecular Formula | C18H21BrN4O2 |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 4-(7-bromo-2-propylimidazo[4,5-c]quinolin-1-yl)butylcarbamic acid |
| SMILES | CCCc1nc2cnc3cc(Br)ccc3c2n1CCCCNC(=O)O |
| InChI | InChI=1S/C18H21BrN4O2/c1-2-5-16-22-15-11-21-14-10-12(19)6-7-13(14)17(15)23(16)9-4-3-8-20-18(24)25/h6-7,10-11,20H,2-5,8-9H2,1H3,(H,24,25) |
| InChIKey | RZHRLDYAUHZILX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|