C18H24N4 — CID 141029789
4-(2-butylimidazo[4,5-c]quinolin-1-yl)butan-1-amine (PubChem CID 141029789) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is 4-(2-butylimidazo[4,5-c]quinolin-1-yl)butan-1-amine.
| Compound Name | 4-(2-butylimidazo[4,5-c]quinolin-1-yl)butan-1-amine |
|---|---|
| PubChem CID | 141029789 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 4-(2-butylimidazo[4,5-c]quinolin-1-yl)butan-1-amine |
| SMILES | CCCCc1nc2cnc3ccccc3c2n1CCCCN |
| InChI | InChI=1S/C18H24N4/c1-2-3-10-17-21-16-13-20-15-9-5-4-8-14(15)18(16)22(17)12-7-6-11-19/h4-5,8-9,13H,2-3,6-7,10-12,19H2,1H3 |
| InChIKey | FCYGDZDUZJALIR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|