C22H33N3OSi — CID 164835966
[7-(2-ethylimidazo[4,5-c]quinolin-1-yl)-2-methylheptan-2-yl]-hydroxy-dimethylsilane (PubChem CID 164835966) has the molecular formula C22H33N3OSi and a molecular weight of 383.61 g/mol. Its IUPAC name is [7-(2-ethylimidazo[4,5-c]quinolin-1-yl)-2-methylheptan-2-yl]-hydroxy-dimethylsilane.
| Compound Name | [7-(2-ethylimidazo[4,5-c]quinolin-1-yl)-2-methylheptan-2-yl]-hydroxy-dimethylsilane |
|---|---|
| PubChem CID | 164835966 |
| Molecular Formula | C22H33N3OSi |
| Molecular Weight | 383.61 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | [7-(2-ethylimidazo[4,5-c]quinolin-1-yl)-2-methylheptan-2-yl]-hydroxy-dimethylsilane |
| SMILES | CCc1nc2cnc3ccccc3c2n1CCCCCC(C)(C)[Si](C)(C)O |
| InChI | InChI=1S/C22H33N3OSi/c1-6-20-24-19-16-23-18-13-9-8-12-17(18)21(19)25(20)15-11-7-10-14-22(2,3)27(4,5)26/h8-9,12-13,16,26H,6-7,10-11,14-15H2,1-5H3 |
| InChIKey | UTSSTENHDHJDEJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|