C27H38N4O4 — CID 86612262
tert-butyl [2,2-dimethylpropanoyl-[4-(2-propylimidazo[4,5-c]quinolin-1-yl)butyl]amino] carbonate (PubChem CID 86612262) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is tert-butyl [2,2-dimethylpropanoyl-[4-(2-propylimidazo[4,5-c]quinolin-1-yl)butyl]amino] carbonate.
| Compound Name | tert-butyl [2,2-dimethylpropanoyl-[4-(2-propylimidazo[4,5-c]quinolin-1-yl)butyl]amino] carbonate |
|---|---|
| PubChem CID | 86612262 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | tert-butyl [2,2-dimethylpropanoyl-[4-(2-propylimidazo[4,5-c]quinolin-1-yl)butyl]amino] carbonate |
| SMILES | CCCc1nc2cnc3ccccc3c2n1CCCCN(OC(=O)OC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C27H38N4O4/c1-8-13-22-29-21-18-28-20-15-10-9-14-19(20)23(21)30(22)16-11-12-17-31(24(32)26(2,3)4)35-25(33)34-27(5,6)7/h9-10,14-15,18H,8,11-13,16-17H2,1-7H3 |
| InChIKey | JGAWTPWZCQCJSK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|