C19H24N4O2 — CID 21075818
tert-butyl N-(2-butylimidazo[4,5-c]quinolin-1-yl)carbamate (PubChem CID 21075818) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is tert-butyl N-(2-butylimidazo[4,5-c]quinolin-1-yl)carbamate.
| Compound Name | tert-butyl N-(2-butylimidazo[4,5-c]quinolin-1-yl)carbamate |
|---|---|
| PubChem CID | 21075818 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | tert-butyl N-(2-butylimidazo[4,5-c]quinolin-1-yl)carbamate |
| SMILES | CCCCc1nc2cnc3ccccc3c2n1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H24N4O2/c1-5-6-11-16-21-15-12-20-14-10-8-7-9-13(14)17(15)23(16)22-18(24)25-19(2,3)4/h7-10,12H,5-6,11H2,1-4H3,(H,22,24) |
| InChIKey | NFBDYFKHLBKSOE-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |