C31H36N4O2 — CID 160837205
tert-butyl N-[5-(1-benzyl-2-butylimidazo[4,5-c]quinolin-8-yl)pent-4-ynyl]carbamate (PubChem CID 160837205) has the molecular formula C31H36N4O2 and a molecular weight of 496.66 g/mol. Its IUPAC name is tert-butyl N-[5-(1-benzyl-2-butylimidazo[4,5-c]quinolin-8-yl)pent-4-ynyl]carbamate.
| Compound Name | tert-butyl N-[5-(1-benzyl-2-butylimidazo[4,5-c]quinolin-8-yl)pent-4-ynyl]carbamate |
|---|---|
| PubChem CID | 160837205 |
| Molecular Formula | C31H36N4O2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | tert-butyl N-[5-(1-benzyl-2-butylimidazo[4,5-c]quinolin-8-yl)pent-4-ynyl]carbamate |
| SMILES | CCCCc1nc2cnc3ccc(C#CCCCNC(=O)OC(C)(C)C)cc3c2n1Cc1ccccc1 |
| InChI | InChI=1S/C31H36N4O2/c1-5-6-16-28-34-27-21-33-26-18-17-23(13-11-8-12-19-32-30(36)37-31(2,3)4)20-25(26)29(27)35(28)22-24-14-9-7-10-15-24/h7,9-10,14-15,17-18,20-21H,5-6,8,12,16,19,22H2,1-4H3,(H,32,36) |
| InChIKey | RZIYMAVHFDMLTG-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|