C22H30N4O3 — CID 86668284
tert-butyl N-[4-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butyl]carbamate (PubChem CID 86668284) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is tert-butyl N-[4-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butyl]carbamate |
|---|---|
| PubChem CID | 86668284 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | tert-butyl N-[4-[2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]butyl]carbamate |
| SMILES | CCOCc1nc2cnc3ccccc3c2n1CCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30N4O3/c1-5-28-15-19-25-18-14-24-17-11-7-6-10-16(17)20(18)26(19)13-9-8-12-23-21(27)29-22(2,3)4/h6-7,10-11,14H,5,8-9,12-13,15H2,1-4H3,(H,23,27) |
| InChIKey | JIHMUMPXMHSOQE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|