C20H25N7O3 — CID 150738364
tert-butyl N-[2-[4-azido-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]ethyl]carbamate (PubChem CID 150738364) has the molecular formula C20H25N7O3 and a molecular weight of 411.47 g/mol. Its IUPAC name is tert-butyl N-[2-[4-azido-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-azido-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 150738364 |
| Molecular Formula | C20H25N7O3 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | tert-butyl N-[2-[4-azido-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]ethyl]carbamate |
| SMILES | CCOCc1nc2c(N=[N+]=[N-])nc3ccccc3c2n1CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H25N7O3/c1-5-29-12-15-24-16-17(27(15)11-10-22-19(28)30-20(2,3)4)13-8-6-7-9-14(13)23-18(16)25-26-21/h6-9H,5,10-12H2,1-4H3,(H,22,28) |
| InChIKey | JTHSFCIGGXCTDQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 127.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|