C18H23N5O4 — CID 90884300
2-[2-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]ethoxy]ethylcarbamic acid (PubChem CID 90884300) has the molecular formula C18H23N5O4 and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-[2-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]ethoxy]ethylcarbamic acid.
| Compound Name | 2-[2-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]ethoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 90884300 |
| Molecular Formula | C18H23N5O4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-[2-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]ethoxy]ethylcarbamic acid |
| SMILES | CCOCc1nc2c(N)nc3ccccc3c2n1CCOCCNC(=O)O |
| InChI | InChI=1S/C18H23N5O4/c1-2-26-11-14-22-15-16(12-5-3-4-6-13(12)21-17(15)19)23(14)8-10-27-9-7-20-18(24)25/h3-6,20H,2,7-11H2,1H3,(H2,19,21)(H,24,25) |
| InChIKey | NZIWZHVEWDRANL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 124.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|