C24H31N7O2 — CID 177290906
tert-butyl N-[(E)-5-(4-azido-2-butylimidazo[4,5-c]quinolin-1-yl)pent-3-enyl]carbamate (PubChem CID 177290906) has the molecular formula C24H31N7O2 and a molecular weight of 449.56 g/mol. Its IUPAC name is tert-butyl N-[(E)-5-(4-azido-2-butylimidazo[4,5-c]quinolin-1-yl)pent-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-5-(4-azido-2-butylimidazo[4,5-c]quinolin-1-yl)pent-3-enyl]carbamate |
|---|---|
| PubChem CID | 177290906 |
| Molecular Formula | C24H31N7O2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | tert-butyl N-[(E)-5-(4-azido-2-butylimidazo[4,5-c]quinolin-1-yl)pent-3-enyl]carbamate |
| SMILES | CCCCc1nc2c(N=[N+]=[N-])nc3ccccc3c2n1C/C=C/CCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H31N7O2/c1-5-6-14-19-28-20-21(17-12-8-9-13-18(17)27-22(20)29-30-25)31(19)16-11-7-10-15-26-23(32)33-24(2,3)4/h7-9,11-13H,5-6,10,14-16H2,1-4H3,(H,26,32)/b11-7+ |
| InChIKey | TWOQZUCZRVHRED-YRNVUSSQSA-N |
| XLogP | 6.34 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|