C29H39ClN4O2 — CID 178085262
tert-butyl N-[[4-[(2-butyl-4-chloroimidazo[4,5-c]quinolin-1-yl)methyl]-1-bicyclo[2.2.2]octanyl]methyl]carbamate (PubChem CID 178085262) has the molecular formula C29H39ClN4O2 and a molecular weight of 511.11 g/mol. Its IUPAC name is tert-butyl N-[[4-[(2-butyl-4-chloroimidazo[4,5-c]quinolin-1-yl)methyl]-1-bicyclo[2.2.2]octanyl]methyl]carbamate.
| Compound Name | tert-butyl N-[[4-[(2-butyl-4-chloroimidazo[4,5-c]quinolin-1-yl)methyl]-1-bicyclo[2.2.2]octanyl]methyl]carbamate |
|---|---|
| PubChem CID | 178085262 |
| Molecular Formula | C29H39ClN4O2 |
| Molecular Weight | 511.11 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | tert-butyl N-[[4-[(2-butyl-4-chloroimidazo[4,5-c]quinolin-1-yl)methyl]-1-bicyclo[2.2.2]octanyl]methyl]carbamate |
| SMILES | CCCCc1nc2c(Cl)nc3ccccc3c2n1CC12CCC(CNC(=O)OC(C)(C)C)(CC1)CC2 |
| InChI | InChI=1S/C29H39ClN4O2/c1-5-6-11-22-33-23-24(20-9-7-8-10-21(20)32-25(23)30)34(22)19-29-15-12-28(13-16-29,14-17-29)18-31-26(35)36-27(2,3)4/h7-10H,5-6,11-19H2,1-4H3,(H,31,35) |
| InChIKey | ULVHSFFMNSQXDA-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.11 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|