C31H40N6O3 — CID 140918542
2-(2,2-dimethylbutanoylamino)ethyl N-[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]carbamate (PubChem CID 140918542) has the molecular formula C31H40N6O3 and a molecular weight of 544.70 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoylamino)ethyl N-[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]carbamate.
| Compound Name | 2-(2,2-dimethylbutanoylamino)ethyl N-[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 140918542 |
| Molecular Formula | C31H40N6O3 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | 2-(2,2-dimethylbutanoylamino)ethyl N-[[4-[(4-amino-2-butylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]carbamate |
| SMILES | CCCCc1nc2c(N)nc3ccccc3c2n1Cc1ccc(CNC(=O)OCCNC(=O)C(C)(C)CC)cc1 |
| InChI | InChI=1S/C31H40N6O3/c1-5-7-12-25-36-26-27(23-10-8-9-11-24(23)35-28(26)32)37(25)20-22-15-13-21(14-16-22)19-34-30(39)40-18-17-33-29(38)31(3,4)6-2/h8-11,13-16H,5-7,12,17-20H2,1-4H3,(H2,32,35)(H,33,38)(H,34,39) |
| InChIKey | QGTAHKBZZOIZHU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|