C28H34N6O2 — CID 135283177
2-(2-methylprop-2-enylamino)ethyl N-[[4-[(4-amino-2-propylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]carbamate (PubChem CID 135283177) has the molecular formula C28H34N6O2 and a molecular weight of 486.62 g/mol. Its IUPAC name is 2-(2-methylprop-2-enylamino)ethyl N-[[4-[(4-amino-2-propylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]carbamate.
| Compound Name | 2-(2-methylprop-2-enylamino)ethyl N-[[4-[(4-amino-2-propylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 135283177 |
| Molecular Formula | C28H34N6O2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 2-(2-methylprop-2-enylamino)ethyl N-[[4-[(4-amino-2-propylimidazo[4,5-c]quinolin-1-yl)methyl]phenyl]methyl]carbamate |
| SMILES | C=C(C)CNCCOC(=O)NCc1ccc(Cn2c(CCC)nc3c(N)nc4ccccc4c32)cc1 |
| InChI | InChI=1S/C28H34N6O2/c1-4-7-24-33-25-26(22-8-5-6-9-23(22)32-27(25)29)34(24)18-21-12-10-20(11-13-21)17-31-28(35)36-15-14-30-16-19(2)3/h5-6,8-13,30H,2,4,7,14-18H2,1,3H3,(H2,29,32)(H,31,35) |
| InChIKey | IJWCHCDAWNQHHB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|