C29H29N7O3 — CID 166066784
2-(2-methylprop-2-enoylamino)ethyl N-[[4-[[4-amino-2-(1H-pyrrol-3-yl)imidazo[4,5-c]quinolin-1-yl]methyl]phenyl]methyl]carbamate (PubChem CID 166066784) has the molecular formula C29H29N7O3 and a molecular weight of 523.60 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoylamino)ethyl N-[[4-[[4-amino-2-(1H-pyrrol-3-yl)imidazo[4,5-c]quinolin-1-yl]methyl]phenyl]methyl]carbamate.
| Compound Name | 2-(2-methylprop-2-enoylamino)ethyl N-[[4-[[4-amino-2-(1H-pyrrol-3-yl)imidazo[4,5-c]quinolin-1-yl]methyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 166066784 |
| Molecular Formula | C29H29N7O3 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 2-(2-methylprop-2-enoylamino)ethyl N-[[4-[[4-amino-2-(1H-pyrrol-3-yl)imidazo[4,5-c]quinolin-1-yl]methyl]phenyl]methyl]carbamate |
| SMILES | C=C(C)C(=O)NCCOC(=O)NCc1ccc(Cn2c(-c3cc[nH]c3)nc3c(N)nc4ccccc4c32)cc1 |
| InChI | InChI=1S/C29H29N7O3/c1-18(2)28(37)32-13-14-39-29(38)33-15-19-7-9-20(10-8-19)17-36-25-22-5-3-4-6-23(22)34-26(30)24(25)35-27(36)21-11-12-31-16-21/h3-12,16,31H,1,13-15,17H2,2H3,(H2,30,34)(H,32,37)(H,33,38) |
| InChIKey | YURQUYYQVDCZBM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 139.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|