C17H16N6O — CID 46225260
4-[2-(1H-indol-6-yl)-7H-purin-6-yl]morpholine (PubChem CID 46225260) has the molecular formula C17H16N6O and a molecular weight of 320.36 g/mol. Its IUPAC name is 4-[2-(1H-indol-6-yl)-7H-purin-6-yl]morpholine.
| Compound Name | 4-[2-(1H-indol-6-yl)-7H-purin-6-yl]morpholine |
|---|---|
| PubChem CID | 46225260 |
| Molecular Formula | C17H16N6O |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 4-[2-(1H-indol-6-yl)-7H-purin-6-yl]morpholine |
| SMILES | c1cc2ccc(-c3nc(N4CCOCC4)c4[nH]cnc4n3)cc2[nH]1 |
| InChI | InChI=1S/C17H16N6O/c1-2-12(9-13-11(1)3-4-18-13)15-21-16-14(19-10-20-16)17(22-15)23-5-7-24-8-6-23/h1-4,9-10,18H,5-8H2,(H,19,20,21,22) |
| InChIKey | LYJKHCYTQHFQLX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 82.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |