C17H17ClN4OS — CID 87344835
4-[6-chloro-2-(1H-indol-5-yl)-5-methylsulfanylpyrimidin-4-yl]morpholine (PubChem CID 87344835) has the molecular formula C17H17ClN4OS and a molecular weight of 360.87 g/mol. Its IUPAC name is 4-[6-chloro-2-(1H-indol-5-yl)-5-methylsulfanylpyrimidin-4-yl]morpholine.
| Compound Name | 4-[6-chloro-2-(1H-indol-5-yl)-5-methylsulfanylpyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 87344835 |
| Molecular Formula | C17H17ClN4OS |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 4-[6-chloro-2-(1H-indol-5-yl)-5-methylsulfanylpyrimidin-4-yl]morpholine |
| SMILES | CSc1c(Cl)nc(-c2ccc3[nH]ccc3c2)nc1N1CCOCC1 |
| InChI | InChI=1S/C17H17ClN4OS/c1-24-14-15(18)20-16(21-17(14)22-6-8-23-9-7-22)12-2-3-13-11(10-12)4-5-19-13/h2-5,10,19H,6-9H2,1H3 |
| InChIKey | GSOXCGIOYVYKRP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |