C27H32ClN7O4S2 — CID 53330034
1-[4-(4-chloro-5-methylsulfanyl-6-morpholin-4-ylpyrimidin-2-yl)phenyl]-3-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]urea (PubChem CID 53330034) has the molecular formula C27H32ClN7O4S2 and a molecular weight of 618.19 g/mol. Its IUPAC name is 1-[4-(4-chloro-5-methylsulfanyl-6-morpholin-4-ylpyrimidin-2-yl)phenyl]-3-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]urea.
| Compound Name | 1-[4-(4-chloro-5-methylsulfanyl-6-morpholin-4-ylpyrimidin-2-yl)phenyl]-3-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 53330034 |
| Molecular Formula | C27H32ClN7O4S2 |
| Molecular Weight | 618.19 g/mol |
| Exact Mass | 617.16 |
| IUPAC Name | 1-[4-(4-chloro-5-methylsulfanyl-6-morpholin-4-ylpyrimidin-2-yl)phenyl]-3-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]urea |
| SMILES | CSc1c(Cl)nc(-c2ccc(NC(=O)Nc3ccc(N4CCN(S(C)(=O)=O)CC4)cc3)cc2)nc1N1CCOCC1 |
| InChI | InChI=1S/C27H32ClN7O4S2/c1-40-23-24(28)31-25(32-26(23)34-15-17-39-18-16-34)19-3-5-20(6-4-19)29-27(36)30-21-7-9-22(10-8-21)33-11-13-35(14-12-33)41(2,37)38/h3-10H,11-18H2,1-2H3,(H2,29,30,36) |
| InChIKey | FWZTUBCZZQVBJU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.19 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|