C22H23ClN6OS2 — CID 88918732
1-[4-(4-amino-6-chloro-5-methylsulfanylpyrimidin-2-yl)phenyl]-3-(4-thiomorpholin-4-ylphenyl)urea (PubChem CID 88918732) has the molecular formula C22H23ClN6OS2 and a molecular weight of 487.05 g/mol. Its IUPAC name is 1-[4-(4-amino-6-chloro-5-methylsulfanylpyrimidin-2-yl)phenyl]-3-(4-thiomorpholin-4-ylphenyl)urea.
| Compound Name | 1-[4-(4-amino-6-chloro-5-methylsulfanylpyrimidin-2-yl)phenyl]-3-(4-thiomorpholin-4-ylphenyl)urea |
|---|---|
| PubChem CID | 88918732 |
| Molecular Formula | C22H23ClN6OS2 |
| Molecular Weight | 487.05 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 1-[4-(4-amino-6-chloro-5-methylsulfanylpyrimidin-2-yl)phenyl]-3-(4-thiomorpholin-4-ylphenyl)urea |
| SMILES | CSc1c(N)nc(-c2ccc(NC(=O)Nc3ccc(N4CCSCC4)cc3)cc2)nc1Cl |
| InChI | InChI=1S/C22H23ClN6OS2/c1-31-18-19(23)27-21(28-20(18)24)14-2-4-15(5-3-14)25-22(30)26-16-6-8-17(9-7-16)29-10-12-32-13-11-29/h2-9H,10-13H2,1H3,(H2,24,27,28)(H2,25,26,30) |
| InChIKey | LHDZCLYBGNPYKG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.05 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|