C26H30N6O2S2 — CID 67297298
1-[4-(5-methylsulfanyl-4-morpholin-4-ylpyrimidin-2-yl)phenyl]-3-(4-thiomorpholin-4-ylphenyl)urea (PubChem CID 67297298) has the molecular formula C26H30N6O2S2 and a molecular weight of 522.70 g/mol. Its IUPAC name is 1-[4-(5-methylsulfanyl-4-morpholin-4-ylpyrimidin-2-yl)phenyl]-3-(4-thiomorpholin-4-ylphenyl)urea.
| Compound Name | 1-[4-(5-methylsulfanyl-4-morpholin-4-ylpyrimidin-2-yl)phenyl]-3-(4-thiomorpholin-4-ylphenyl)urea |
|---|---|
| PubChem CID | 67297298 |
| Molecular Formula | C26H30N6O2S2 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 1-[4-(5-methylsulfanyl-4-morpholin-4-ylpyrimidin-2-yl)phenyl]-3-(4-thiomorpholin-4-ylphenyl)urea |
| SMILES | CSc1cnc(-c2ccc(NC(=O)Nc3ccc(N4CCSCC4)cc3)cc2)nc1N1CCOCC1 |
| InChI | InChI=1S/C26H30N6O2S2/c1-35-23-18-27-24(30-25(23)32-10-14-34-15-11-32)19-2-4-20(5-3-19)28-26(33)29-21-6-8-22(9-7-21)31-12-16-36-17-13-31/h2-9,18H,10-17H2,1H3,(H2,28,29,33) |
| InChIKey | HRHMOGZSCOJXLJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|