C22H24N6OS2 — CID 86673506
1-(2-aminophenyl)-3-[4-(5-methylsulfanyl-4-morpholin-4-ylpyrimidin-2-yl)phenyl]thiourea (PubChem CID 86673506) has the molecular formula C22H24N6OS2 and a molecular weight of 452.61 g/mol. Its IUPAC name is 1-(2-aminophenyl)-3-[4-(5-methylsulfanyl-4-morpholin-4-ylpyrimidin-2-yl)phenyl]thiourea.
| Compound Name | 1-(2-aminophenyl)-3-[4-(5-methylsulfanyl-4-morpholin-4-ylpyrimidin-2-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 86673506 |
| Molecular Formula | C22H24N6OS2 |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | 1-(2-aminophenyl)-3-[4-(5-methylsulfanyl-4-morpholin-4-ylpyrimidin-2-yl)phenyl]thiourea |
| SMILES | CSc1cnc(-c2ccc(NC(=S)Nc3ccccc3N)cc2)nc1N1CCOCC1 |
| InChI | InChI=1S/C22H24N6OS2/c1-31-19-14-24-20(27-21(19)28-10-12-29-13-11-28)15-6-8-16(9-7-15)25-22(30)26-18-5-3-2-4-17(18)23/h2-9,14H,10-13,23H2,1H3,(H2,25,26,30) |
| InChIKey | RPGCANPMXXRLRA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|