C19H22N6OS — CID 153499684
1-ethyl-3-[4-(4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)phenyl]thiourea (PubChem CID 153499684) has the molecular formula C19H22N6OS and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-ethyl-3-[4-(4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)phenyl]thiourea.
| Compound Name | 1-ethyl-3-[4-(4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 153499684 |
| Molecular Formula | C19H22N6OS |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-ethyl-3-[4-(4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)phenyl]thiourea |
| SMILES | CCNC(=S)Nc1ccc(-c2nc(N3CCOCC3)c3cccn3n2)cc1 |
| InChI | InChI=1S/C19H22N6OS/c1-2-20-19(27)21-15-7-5-14(6-8-15)17-22-18(24-10-12-26-13-11-24)16-4-3-9-25(16)23-17/h3-9H,2,10-13H2,1H3,(H2,20,21,27) |
| InChIKey | LRTKMZBOTSZCMH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 66.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|