C20H21N7O2 — CID 145420362
1-(2-cyanoethyl)-3-[4-(4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)phenyl]urea (PubChem CID 145420362) has the molecular formula C20H21N7O2 and a molecular weight of 391.44 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-3-[4-(4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)phenyl]urea.
| Compound Name | 1-(2-cyanoethyl)-3-[4-(4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 145420362 |
| Molecular Formula | C20H21N7O2 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 1-(2-cyanoethyl)-3-[4-(4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)phenyl]urea |
| SMILES | N#CCCNC(=O)Nc1ccc(-c2nc(N3CCOCC3)c3cccn3n2)cc1 |
| InChI | InChI=1S/C20H21N7O2/c21-8-2-9-22-20(28)23-16-6-4-15(5-7-16)18-24-19(26-11-13-29-14-12-26)17-3-1-10-27(17)25-18/h1,3-7,10H,2,9,11-14H2,(H2,22,23,28) |
| InChIKey | GMPDJPNRANUNKS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 107.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|