C23H21N9O — CID 146670460
1-cyano-2-[4-(4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)phenyl]-3-pyridin-3-ylguanidine (PubChem CID 146670460) has the molecular formula C23H21N9O and a molecular weight of 439.48 g/mol. Its IUPAC name is 1-cyano-2-[4-(4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)phenyl]-3-pyridin-3-ylguanidine.
| Compound Name | 1-cyano-2-[4-(4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)phenyl]-3-pyridin-3-ylguanidine |
|---|---|
| PubChem CID | 146670460 |
| Molecular Formula | C23H21N9O |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 1-cyano-2-[4-(4-morpholin-4-ylpyrrolo[2,1-f][1,2,4]triazin-2-yl)phenyl]-3-pyridin-3-ylguanidine |
| SMILES | N#CN/C(=N\c1ccc(-c2nc(N3CCOCC3)c3cccn3n2)cc1)Nc1cccnc1 |
| InChI | InChI=1S/C23H21N9O/c24-16-26-23(28-19-3-1-9-25-15-19)27-18-7-5-17(6-8-18)21-29-22(31-11-13-33-14-12-31)20-4-2-10-32(20)30-21/h1-10,15H,11-14H2,(H2,26,27,28) |
| InChIKey | GRMCPBXXCNQNPO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|